C27H33F2N3O4S2 — CID 142522500
2-(2-aminosulfanyl-1,3-thiazol-5-yl)propan-2-ol;2-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 142522500) has the molecular formula C27H33F2N3O4S2 and a molecular weight of 565.71 g/mol. Its IUPAC name is 2-(2-aminosulfanyl-1,3-thiazol-5-yl)propan-2-ol;2-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | 2-(2-aminosulfanyl-1,3-thiazol-5-yl)propan-2-ol;2-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 142522500 |
| Molecular Formula | C27H33F2N3O4S2 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 2-(2-aminosulfanyl-1,3-thiazol-5-yl)propan-2-ol;2-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(C)(O)c1cnc(SN)s1.CC(C)c1cc(-c2ccc3c(c2)OC(F)(F)O3)cc(C(C)C)c1CC(N)=O |
| InChI | InChI=1S/C21H23F2NO3.C6H10N2OS2/c1-11(2)15-7-14(8-16(12(3)4)17(15)10-20(24)25)13-5-6-18-19(9-13)27-21(22,23)26-18;1-6(2,9)4-3-8-5(10-4)11-7/h5-9,11-12H,10H2,1-4H3,(H2,24,25);3,9H,7H2,1-2H3 |
| InChIKey | RUAIAOZHYMQXDW-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|