About tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane
tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane (PubChem CID 142522798) has the molecular formula C13H25N3O4S2
and a molecular weight of 351.49 g/mol. Its IUPAC name is tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane.
Molecular Properties
| Compound Name | tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane |
| PubChem CID | 142522798 |
| Molecular Formula | C13H25N3O4S2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N=S(N)(=O)c1cnc(C(C)(C)O)s1 |
| InChI | InChI=1S/C11H19N3O4S2.C2H6/c1-10(2,3)18-9(15)14-20(12,17)7-6-13-8(19-7)11(4,5)16;1-2/h6,16H,1-5H3,(H2,12,14,15,17);1-2H3 |
| InChIKey | PVBBRRZWTPLNPE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane?
The IUPAC name of tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane (CID 142522798) is tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane.
What is the SMILES notation for tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane?
The canonical SMILES for tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane is CC.CC(C)(C)OC(=O)N=S(N)(=O)c1cnc(C(C)(C)O)s1.
What is the InChIKey of tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane?
The InChIKey is PVBBRRZWTPLNPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O4S2.C2H6/c1-10(2,3)18-9(15)14-20(12,17)7-6-13-8(19-7)11(4,5)16;1-2/h6,16H,1-5H3,(H2,12,14,15,17);1-2H3.
What are the key properties of tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane?
tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane has a molecular weight of 351.49 g/mol, XLogP of 3.03, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[amino-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]carbamate;ethane is sourced from PubChem (CID 142522798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).