About (2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide
(2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide (PubChem CID 142522860) has the molecular formula C16H24N4O3S2
and a molecular weight of 384.53 g/mol. Its IUPAC name is (2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide.
Molecular Properties
| Compound Name | (2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide |
| PubChem CID | 142522860 |
| Molecular Formula | C16H24N4O3S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide |
| SMILES | Cc1cc(NC(N)=O)cc(C)n1.Cc1cc(S(N)=O)sc1C(C)(C)O |
| InChI | InChI=1S/C8H11N3O.C8H13NO2S2/c1-5-3-7(11-8(9)12)4-6(2)10-5;1-5-4-6(13(9)11)12-7(5)8(2,3)10/h3-4H,1-2H3,(H3,9,10,11,12);4,10H,9H2,1-3H3 |
| InChIKey | GMGKAABHKYCIJR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide?
The IUPAC name of (2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide (CID 142522860) is (2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide.
What is the SMILES notation for (2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide?
The canonical SMILES for (2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide is Cc1cc(NC(N)=O)cc(C)n1.Cc1cc(S(N)=O)sc1C(C)(C)O.
What is the InChIKey of (2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide?
The InChIKey is GMGKAABHKYCIJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O.C8H13NO2S2/c1-5-3-7(11-8(9)12)4-6(2)10-5;1-5-4-6(13(9)11)12-7(5)8(2,3)10/h3-4H,1-2H3,(H3,9,10,11,12);4,10H,9H2,1-3H3.
What are the key properties of (2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide?
(2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide has a molecular weight of 384.53 g/mol, XLogP of 2.45, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethyl-4-pyridinyl)urea;5-(2-hydroxypropan-2-yl)-4-methylthiophene-2-sulfinamide is sourced from PubChem (CID 142522860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).