About ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide
ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide (PubChem CID 142522939) has the molecular formula C11H24N2O2S2
and a molecular weight of 280.46 g/mol. Its IUPAC name is ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide.
Molecular Properties
| Compound Name | ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide |
| PubChem CID | 142522939 |
| Molecular Formula | C11H24N2O2S2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide |
| SMILES | CC.CC.COC(C)(C)c1ncc(S(N)=O)s1 |
| InChI | InChI=1S/C7H12N2O2S2.2C2H6/c1-7(2,11-3)6-9-4-5(12-6)13(8)10;2*1-2/h4H,8H2,1-3H3;2*1-2H3 |
| InChIKey | XJAOEYSYRHZYBR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide?
The IUPAC name of ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide (CID 142522939) is ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide.
What is the SMILES notation for ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide?
The canonical SMILES for ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide is CC.CC.COC(C)(C)c1ncc(S(N)=O)s1.
What is the InChIKey of ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide?
The InChIKey is XJAOEYSYRHZYBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2S2.2C2H6/c1-7(2,11-3)6-9-4-5(12-6)13(8)10;2*1-2/h4H,8H2,1-3H3;2*1-2H3.
What are the key properties of ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide?
ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide has a molecular weight of 280.46 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(2-methoxypropan-2-yl)-1,3-thiazole-5-sulfinamide is sourced from PubChem (CID 142522939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).