C19H22BBrN4O — CID 142523011
3-bromo-7-cyano-N-(3-methylphenyl)-6,8-dihydro-5H-imidazo[1,5-a][1,4]azaborinine-1-carboxamide;(Z)-but-2-ene (PubChem CID 142523011) has the molecular formula C19H22BBrN4O and a molecular weight of 413.13 g/mol. Its IUPAC name is 3-bromo-7-cyano-N-(3-methylphenyl)-6,8-dihydro-5H-imidazo[1,5-a][1,4]azaborinine-1-carboxamide;(Z)-but-2-ene.
| Compound Name | 3-bromo-7-cyano-N-(3-methylphenyl)-6,8-dihydro-5H-imidazo[1,5-a][1,4]azaborinine-1-carboxamide;(Z)-but-2-ene |
|---|---|
| PubChem CID | 142523011 |
| Molecular Formula | C19H22BBrN4O |
| Molecular Weight | 413.13 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 3-bromo-7-cyano-N-(3-methylphenyl)-6,8-dihydro-5H-imidazo[1,5-a][1,4]azaborinine-1-carboxamide;(Z)-but-2-ene |
| SMILES | C/C=C\C.Cc1cccc(NC(=O)c2nc(Br)n3c2CB(C#N)CC3)c1 |
| InChI | InChI=1S/C15H14BBrN4O.C4H8/c1-10-3-2-4-11(7-10)19-14(22)13-12-8-16(9-18)5-6-21(12)15(17)20-13;1-3-4-2/h2-4,7H,5-6,8H2,1H3,(H,19,22);3-4H,1-2H3/b;4-3- |
| InChIKey | YXWGOCODHWOCCF-QGAMPUOQSA-N |
| XLogP | 4.44 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.13 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|