About N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane
N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane (PubChem CID 142523048) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane.
Molecular Properties
| Compound Name | N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane |
| PubChem CID | 142523048 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane |
| SMILES | C=C(C)/C=N/C(CNC)=C(C)C.CCC |
| InChI | InChI=1S/C10H18N2.C3H8/c1-8(2)6-12-10(7-11-5)9(3)4;1-3-2/h6,11H,1,7H2,2-5H3;3H2,1-2H3/b12-6+; |
| InChIKey | TUZLEMAXJXTQOI-WXIWBVQFSA-N |
| XLogP | 3.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane?
The IUPAC name of N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane (CID 142523048) is N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane.
What is the SMILES notation for N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane?
The canonical SMILES for N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane is C=C(C)/C=N/C(CNC)=C(C)C.CCC.
What is the InChIKey of N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane?
The InChIKey is TUZLEMAXJXTQOI-WXIWBVQFSA-N. The full InChI is InChI=1S/C10H18N2.C3H8/c1-8(2)6-12-10(7-11-5)9(3)4;1-3-2/h6,11H,1,7H2,2-5H3;3H2,1-2H3/b12-6+;.
What are the key properties of N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane?
N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane has a molecular weight of 210.36 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethyl-2-(2-methylprop-2-enylideneamino)but-2-en-1-amine;propane is sourced from PubChem (CID 142523048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).