C10H14FNO — CID 142523117
(2E,4E)-5-fluoro-N,2,6-trimethylhepta-2,4,6-trienamide (PubChem CID 142523117) has the molecular formula C10H14FNO and a molecular weight of 183.23 g/mol. Its IUPAC name is (2E,4E)-5-fluoro-N,2,6-trimethylhepta-2,4,6-trienamide.
| Compound Name | (2E,4E)-5-fluoro-N,2,6-trimethylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 142523117 |
| Molecular Formula | C10H14FNO |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | (2E,4E)-5-fluoro-N,2,6-trimethylhepta-2,4,6-trienamide |
| SMILES | C=C(C)/C(F)=C\C=C(/C)C(=O)NC |
| InChI | InChI=1S/C10H14FNO/c1-7(2)9(11)6-5-8(3)10(13)12-4/h5-6H,1H2,2-4H3,(H,12,13)/b8-5+,9-6+ |
| InChIKey | DVCBTXQAXOMQRP-XVYDYJIPSA-N |
| XLogP | 2.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|