C14H27N3 — CID 142523610
ethane;(1E,3Z)-N'-ethenyl-1-(1-methylpiperidin-3-yl)buta-1,3-diene-1,4-diamine (PubChem CID 142523610) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is ethane;(1E,3Z)-N'-ethenyl-1-(1-methylpiperidin-3-yl)buta-1,3-diene-1,4-diamine.
| Compound Name | ethane;(1E,3Z)-N'-ethenyl-1-(1-methylpiperidin-3-yl)buta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 142523610 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | ethane;(1E,3Z)-N'-ethenyl-1-(1-methylpiperidin-3-yl)buta-1,3-diene-1,4-diamine |
| SMILES | C=CN/C=C\C=C(\N)C1CCCN(C)C1.CC |
| InChI | InChI=1S/C12H21N3.C2H6/c1-3-14-8-4-7-12(13)11-6-5-9-15(2)10-11;1-2/h3-4,7-8,11,14H,1,5-6,9-10,13H2,2H3;1-2H3/b8-4-,12-7+; |
| InChIKey | IPCQFIRRTMWHQH-NFZKUONPSA-N |
| XLogP | 2.44 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|