About 3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one
3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one (PubChem CID 142523769) has the molecular formula C10H11FN2O2
and a molecular weight of 210.21 g/mol. Its IUPAC name is 3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one.
Molecular Properties
| Compound Name | 3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one |
| PubChem CID | 142523769 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one |
| SMILES | Nc1cc(F)cn(C2=CCOCC2)c1=O |
| InChI | InChI=1S/C10H11FN2O2/c11-7-5-9(12)10(14)13(6-7)8-1-3-15-4-2-8/h1,5-6H,2-4,12H2 |
| InChIKey | OJAMEZKQJOMKBR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one?
The IUPAC name of 3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one (CID 142523769) is 3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one.
What is the SMILES notation for 3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one?
The canonical SMILES for 3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one is Nc1cc(F)cn(C2=CCOCC2)c1=O.
What is the InChIKey of 3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one?
The InChIKey is OJAMEZKQJOMKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O2/c11-7-5-9(12)10(14)13(6-7)8-1-3-15-4-2-8/h1,5-6H,2-4,12H2.
What are the key properties of 3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one?
3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one has a molecular weight of 210.21 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(3,6-dihydro-2H-pyran-4-yl)-5-fluoropyridin-2-one is sourced from PubChem (CID 142523769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).