C18H18B3N7O2 — CID 142523922
CID 142523922 (PubChem CID 142523922) has the molecular formula C18H18B3N7O2 and a molecular weight of 396.83 g/mol.
| Compound Name | CID 142523922 |
|---|---|
| PubChem CID | 142523922 |
| Molecular Formula | C18H18B3N7O2 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])Oc1ncccc1Nc1cc(NC)n2ncc(C(=O)NC3CCC3)c2n1 |
| InChI | InChI=1S/C18H18B3N7O2/c1-22-14-8-13(26-12-6-3-7-23-17(12)30-18(19,20)21)27-15-11(9-24-28(14)15)16(29)25-10-4-2-5-10/h3,6-10,22H,2,4-5H2,1H3,(H,25,29)(H,26,27) |
| InChIKey | VIMSCISLKTZVLA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|