About 2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane
2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane (PubChem CID 142524736) has the molecular formula C20H26F2N2
and a molecular weight of 332.44 g/mol. Its IUPAC name is 2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane.
Molecular Properties
| Compound Name | 2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane |
| PubChem CID | 142524736 |
| Molecular Formula | C20H26F2N2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane |
| SMILES | CCC.NC1CCNC1Cc1cccc(-c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C17H18F2N2.C3H8/c18-14-8-13(9-15(19)10-14)12-3-1-2-11(6-12)7-17-16(20)4-5-21-17;1-3-2/h1-3,6,8-10,16-17,21H,4-5,7,20H2;3H2,1-2H3 |
| InChIKey | UPZQKADBOPIFQE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane?
The IUPAC name of 2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane (CID 142524736) is 2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane.
What is the SMILES notation for 2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane?
The canonical SMILES for 2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane is CCC.NC1CCNC1Cc1cccc(-c2cc(F)cc(F)c2)c1.
What is the InChIKey of 2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane?
The InChIKey is UPZQKADBOPIFQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F2N2.C3H8/c18-14-8-13(9-15(19)10-14)12-3-1-2-11(6-12)7-17-16(20)4-5-21-17;1-3-2/h1-3,6,8-10,16-17,21H,4-5,7,20H2;3H2,1-2H3.
What are the key properties of 2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane?
2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane has a molecular weight of 332.44 g/mol, XLogP of 4.28, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(3,5-difluorophenyl)phenyl]methyl]pyrrolidin-3-amine;propane is sourced from PubChem (CID 142524736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).