About 3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine
3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine (PubChem CID 142525112) has the molecular formula C20H29N3O2
and a molecular weight of 343.47 g/mol. Its IUPAC name is 3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine.
Molecular Properties
| Compound Name | 3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine |
| PubChem CID | 142525112 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine |
| SMILES | CC.CC1CCNC1.[H]/N=C/c1c(N)cc(-c2ccc(O)cc2)cc1O |
| InChI | InChI=1S/C13H12N2O2.C5H11N.C2H6/c14-7-11-12(15)5-9(6-13(11)17)8-1-3-10(16)4-2-8;1-5-2-3-6-4-5;1-2/h1-7,14,16-17H,15H2;5-6H,2-4H2,1H3;1-2H3/b14-7+;; |
| InChIKey | WFPHDQYFAAKUOW-MOEKMLTRSA-N |
| XLogP | 3.99 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine?
The IUPAC name of 3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine (CID 142525112) is 3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine.
What is the SMILES notation for 3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine?
The canonical SMILES for 3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine is CC.CC1CCNC1.[H]/N=C/c1c(N)cc(-c2ccc(O)cc2)cc1O.
What is the InChIKey of 3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine?
The InChIKey is WFPHDQYFAAKUOW-MOEKMLTRSA-N. The full InChI is InChI=1S/C13H12N2O2.C5H11N.C2H6/c14-7-11-12(15)5-9(6-13(11)17)8-1-3-10(16)4-2-8;1-5-2-3-6-4-5;1-2/h1-7,14,16-17H,15H2;5-6H,2-4H2,1H3;1-2H3/b14-7+;;.
What are the key properties of 3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine?
3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine has a molecular weight of 343.47 g/mol, XLogP of 3.99, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(4-hydroxyphenyl)-2-methanimidoylphenol;ethane;3-methylpyrrolidine is sourced from PubChem (CID 142525112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).