About 2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate
2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate (PubChem CID 142525457) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is 2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate.
Molecular Properties
| Compound Name | 2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate |
| PubChem CID | 142525457 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate |
| SMILES | C=Cc1ccc(NC(=O)OCC(C)C(C)C)nc1C |
| InChI | InChI=1S/C15H22N2O2/c1-6-13-7-8-14(16-12(13)5)17-15(18)19-9-11(4)10(2)3/h6-8,10-11H,1,9H2,2-5H3,(H,16,17,18) |
| InChIKey | DIENLSGRJSJWME-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate?
The IUPAC name of 2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate (CID 142525457) is 2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate.
What is the SMILES notation for 2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate?
The canonical SMILES for 2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate is C=Cc1ccc(NC(=O)OCC(C)C(C)C)nc1C.
What is the InChIKey of 2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate?
The InChIKey is DIENLSGRJSJWME-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-6-13-7-8-14(16-12(13)5)17-15(18)19-9-11(4)10(2)3/h6-8,10-11H,1,9H2,2-5H3,(H,16,17,18).
What are the key properties of 2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate?
2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate has a molecular weight of 262.35 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutyl N-(5-ethenyl-6-methyl-2-pyridinyl)carbamate is sourced from PubChem (CID 142525457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).