About 5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine
5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine (PubChem CID 142525744) has the molecular formula C13H16N2O2
and a molecular weight of 232.28 g/mol. Its IUPAC name is 5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine.
Molecular Properties
| Compound Name | 5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine |
| PubChem CID | 142525744 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine |
| SMILES | CN.c1cc2c(c(-c3ccno3)c1)CCOC2 |
| InChI | InChI=1S/C12H11NO2.CH5N/c1-2-9-8-14-7-5-10(9)11(3-1)12-4-6-13-15-12;1-2/h1-4,6H,5,7-8H2;2H2,1H3 |
| InChIKey | QSLWQGWQNBCJJH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine?
The IUPAC name of 5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine (CID 142525744) is 5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine.
What is the SMILES notation for 5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine?
The canonical SMILES for 5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine is CN.c1cc2c(c(-c3ccno3)c1)CCOC2.
What is the InChIKey of 5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine?
The InChIKey is QSLWQGWQNBCJJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2.CH5N/c1-2-9-8-14-7-5-10(9)11(3-1)12-4-6-13-15-12;1-2/h1-4,6H,5,7-8H2;2H2,1H3.
What are the key properties of 5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine?
5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine has a molecular weight of 232.28 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dihydro-1H-isochromen-5-yl)-1,2-oxazole;methanamine is sourced from PubChem (CID 142525744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).