About 4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine
4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine (PubChem CID 142525785) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine |
| PubChem CID | 142525785 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine |
| SMILES | CN(C)C.c1cc2c(c(-c3ccncc3)c1)CCOC2 |
| InChI | InChI=1S/C14H13NO.C3H9N/c1-2-12-10-16-9-6-14(12)13(3-1)11-4-7-15-8-5-11;1-4(2)3/h1-5,7-8H,6,9-10H2;1-3H3 |
| InChIKey | INEJKCZTVDNSQH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine?
The IUPAC name of 4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine (CID 142525785) is 4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine.
What is the SMILES notation for 4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine?
The canonical SMILES for 4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine is CN(C)C.c1cc2c(c(-c3ccncc3)c1)CCOC2.
What is the InChIKey of 4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine?
The InChIKey is INEJKCZTVDNSQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO.C3H9N/c1-2-12-10-16-9-6-14(12)13(3-1)11-4-7-15-8-5-11;1-4(2)3/h1-5,7-8H,6,9-10H2;1-3H3.
What are the key properties of 4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine?
4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine has a molecular weight of 270.38 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydro-1H-isochromen-5-yl)pyridine;N,N-dimethylmethanamine is sourced from PubChem (CID 142525785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).