C17H23NO4 — CID 142526870
benzyl 4-[(3R)-3-(hydroxymethyl)piperidin-1-yl]-4-oxobutanoate (PubChem CID 142526870) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is benzyl 4-[(3R)-3-(hydroxymethyl)piperidin-1-yl]-4-oxobutanoate.
| Compound Name | benzyl 4-[(3R)-3-(hydroxymethyl)piperidin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 142526870 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | benzyl 4-[(3R)-3-(hydroxymethyl)piperidin-1-yl]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)N1CCC[C@@H](CO)C1)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c19-12-15-7-4-10-18(11-15)16(20)8-9-17(21)22-13-14-5-2-1-3-6-14/h1-3,5-6,15,19H,4,7-13H2/t15-/m1/s1 |
| InChIKey | UBGIWJBIZUIVFV-OAHLLOKOSA-N |
| XLogP | 1.74 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |