C23H25N3O4 — CID 142527037
methyl 2-[3-[[6-[2-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]oxymethyl]phenyl]acetate (PubChem CID 142527037) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is methyl 2-[3-[[6-[2-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]oxymethyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[[6-[2-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]oxymethyl]phenyl]acetate |
|---|---|
| PubChem CID | 142527037 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | methyl 2-[3-[[6-[2-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]oxymethyl]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(COc2ccc(-c3ccnn3C3CCCCO3)nc2)c1 |
| InChI | InChI=1S/C23H25N3O4/c1-28-23(27)14-17-5-4-6-18(13-17)16-30-19-8-9-20(24-15-19)21-10-11-25-26(21)22-7-2-3-12-29-22/h4-6,8-11,13,15,22H,2-3,7,12,14,16H2,1H3 |
| InChIKey | QDKPXSPFMOZUOU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |