C36H37NO5 — CID 142527319
[2-(4-methyl-1,3-dioxoinden-2-yl)quinolin-8-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 142527319) has the molecular formula C36H37NO5 and a molecular weight of 563.69 g/mol. Its IUPAC name is [2-(4-methyl-1,3-dioxoinden-2-yl)quinolin-8-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | [2-(4-methyl-1,3-dioxoinden-2-yl)quinolin-8-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 142527319 |
| Molecular Formula | C36H37NO5 |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | [2-(4-methyl-1,3-dioxoinden-2-yl)quinolin-8-yl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | Cc1cccc2c1C(=O)C(c1ccc3cccc(OC(=O)CCc4cc(C(C)(C)C)c(O)c(C(C)(C)C)c4)c3n1)C2=O |
| InChI | InChI=1S/C36H37NO5/c1-20-10-8-12-23-29(20)34(41)30(32(23)39)26-16-15-22-11-9-13-27(31(22)37-26)42-28(38)17-14-21-18-24(35(2,3)4)33(40)25(19-21)36(5,6)7/h8-13,15-16,18-19,30,40H,14,17H2,1-7H3 |
| InChIKey | LPFQEALLAJUTAG-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|