C33H27Cl4NO5 — CID 142527484
[2-(4,5,6,7-tetrachloro-1,3-dioxoinden-2-yl)quinolin-8-yl] 3,5-ditert-butyl-4-hydroxybenzoate (PubChem CID 142527484) has the molecular formula C33H27Cl4NO5 and a molecular weight of 659.39 g/mol. Its IUPAC name is [2-(4,5,6,7-tetrachloro-1,3-dioxoinden-2-yl)quinolin-8-yl] 3,5-ditert-butyl-4-hydroxybenzoate.
| Compound Name | [2-(4,5,6,7-tetrachloro-1,3-dioxoinden-2-yl)quinolin-8-yl] 3,5-ditert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 142527484 |
| Molecular Formula | C33H27Cl4NO5 |
| Molecular Weight | 659.39 g/mol |
| Exact Mass | 657.06 |
| IUPAC Name | [2-(4,5,6,7-tetrachloro-1,3-dioxoinden-2-yl)quinolin-8-yl] 3,5-ditert-butyl-4-hydroxybenzoate |
| SMILES | CC(C)(C)c1cc(C(=O)Oc2cccc3ccc(C4C(=O)c5c(Cl)c(Cl)c(Cl)c(Cl)c5C4=O)nc23)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C33H27Cl4NO5/c1-32(2,3)16-12-15(13-17(28(16)39)33(4,5)6)31(42)43-19-9-7-8-14-10-11-18(38-27(14)19)20-29(40)21-22(30(20)41)24(35)26(37)25(36)23(21)34/h7-13,20,39H,1-6H3 |
| InChIKey | ZAAYFYOSMUBVTP-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.39 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|