C38H38N2O4 — CID 142527581
2-[8-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxy]quinolin-2-yl]-6-(methylamino)cyclopenta[b]naphthalene-1,3-dione (PubChem CID 142527581) has the molecular formula C38H38N2O4 and a molecular weight of 586.73 g/mol. Its IUPAC name is 2-[8-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxy]quinolin-2-yl]-6-(methylamino)cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[8-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxy]quinolin-2-yl]-6-(methylamino)cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 142527581 |
| Molecular Formula | C38H38N2O4 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | 2-[8-[(3,5-ditert-butyl-4-hydroxyphenyl)methoxy]quinolin-2-yl]-6-(methylamino)cyclopenta[b]naphthalene-1,3-dione |
| SMILES | CNc1ccc2cc3c(cc2c1)C(=O)C(c1ccc2cccc(OCc4cc(C(C)(C)C)c(O)c(C(C)(C)C)c4)c2n1)C3=O |
| InChI | InChI=1S/C38H38N2O4/c1-37(2,3)28-15-21(16-29(36(28)43)38(4,5)6)20-44-31-10-8-9-22-12-14-30(40-33(22)31)32-34(41)26-18-23-11-13-25(39-7)17-24(23)19-27(26)35(32)42/h8-19,32,39,43H,20H2,1-7H3 |
| InChIKey | NYICQSAZNCUPRL-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|