About O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine
O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine (PubChem CID 142527856) has the molecular formula C8H16F2N2O
and a molecular weight of 194.22 g/mol. Its IUPAC name is O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine |
| PubChem CID | 142527856 |
| Molecular Formula | C8H16F2N2O |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine |
| SMILES | NOCCCN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C8H16F2N2O/c9-8(10)2-5-12(6-3-8)4-1-7-13-11/h1-7,11H2 |
| InChIKey | MDGGGDNGWGTYGN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine?
The IUPAC name of O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine (CID 142527856) is O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine.
What is the SMILES notation for O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine?
The canonical SMILES for O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine is NOCCCN1CCC(F)(F)CC1.
What is the InChIKey of O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine?
The InChIKey is MDGGGDNGWGTYGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2O/c9-8(10)2-5-12(6-3-8)4-1-7-13-11/h1-7,11H2.
What are the key properties of O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine?
O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine has a molecular weight of 194.22 g/mol, XLogP of 1.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[3-(4,4-difluoropiperidin-1-yl)propyl]hydroxylamine is sourced from PubChem (CID 142527856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).