C20H25ClF3N3O3 — CID 142528168
2-(4-chloro-3-fluorophenoxy)-N-[3-[5-[2-(difluoromethyl)butyl]-1,3,4-oxadiazol-2-yl]propyl]acetamide;ethene (PubChem CID 142528168) has the molecular formula C20H25ClF3N3O3 and a molecular weight of 447.89 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenoxy)-N-[3-[5-[2-(difluoromethyl)butyl]-1,3,4-oxadiazol-2-yl]propyl]acetamide;ethene.
| Compound Name | 2-(4-chloro-3-fluorophenoxy)-N-[3-[5-[2-(difluoromethyl)butyl]-1,3,4-oxadiazol-2-yl]propyl]acetamide;ethene |
|---|---|
| PubChem CID | 142528168 |
| Molecular Formula | C20H25ClF3N3O3 |
| Molecular Weight | 447.89 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 2-(4-chloro-3-fluorophenoxy)-N-[3-[5-[2-(difluoromethyl)butyl]-1,3,4-oxadiazol-2-yl]propyl]acetamide;ethene |
| SMILES | C=C.CCC(Cc1nnc(CCCNC(=O)COc2ccc(Cl)c(F)c2)o1)C(F)F |
| InChI | InChI=1S/C18H21ClF3N3O3.C2H4/c1-2-11(18(21)22)8-17-25-24-16(28-17)4-3-7-23-15(26)10-27-12-5-6-13(19)14(20)9-12;1-2/h5-6,9,11,18H,2-4,7-8,10H2,1H3,(H,23,26);1-2H2 |
| InChIKey | LFNACNGWJVQBPM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.89 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|