C12H18FNO2 — CID 142528171
2-[(2E,4E,6Z)-5-fluoro-6-methylocta-2,4,6-trien-3-yl]oxy-N-methylacetamide (PubChem CID 142528171) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is 2-[(2E,4E,6Z)-5-fluoro-6-methylocta-2,4,6-trien-3-yl]oxy-N-methylacetamide.
| Compound Name | 2-[(2E,4E,6Z)-5-fluoro-6-methylocta-2,4,6-trien-3-yl]oxy-N-methylacetamide |
|---|---|
| PubChem CID | 142528171 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-[(2E,4E,6Z)-5-fluoro-6-methylocta-2,4,6-trien-3-yl]oxy-N-methylacetamide |
| SMILES | C/C=C(C)\C(F)=C/C(=C\C)OCC(=O)NC |
| InChI | InChI=1S/C12H18FNO2/c1-5-9(3)11(13)7-10(6-2)16-8-12(15)14-4/h5-7H,8H2,1-4H3,(H,14,15)/b9-5-,10-6+,11-7+ |
| InChIKey | FEBJFQLIVYGZOC-POSDUOPQSA-N |
| XLogP | 2.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|