C22H33N3O5 — CID 142528226
7-[(R)-1-[[(Z)-pent-3-en-2-yl]oxymethoxy]ethoxy-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl]pyrrolo[2,3-d]pyrimidine (PubChem CID 142528226) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is 7-[(R)-1-[[(Z)-pent-3-en-2-yl]oxymethoxy]ethoxy-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl]pyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-[(R)-1-[[(Z)-pent-3-en-2-yl]oxymethoxy]ethoxy-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl]pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 142528226 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 7-[(R)-1-[[(Z)-pent-3-en-2-yl]oxymethoxy]ethoxy-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl]pyrrolo[2,3-d]pyrimidine |
| SMILES | C/C=C\C(C)OCOC(C)O[C@H]([C@@H]1OC(C)(C)OC1(C)C)n1ccc2cncnc21 |
| InChI | InChI=1S/C22H33N3O5/c1-8-9-15(2)26-14-27-16(3)28-20(18-21(4,5)30-22(6,7)29-18)25-11-10-17-12-23-13-24-19(17)25/h8-13,15-16,18,20H,14H2,1-7H3/b9-8-/t15?,16?,18-,20+/m0/s1 |
| InChIKey | CHXVBTRIVVDULV-KTNDRZPFSA-N |
| XLogP | 4.18 |
| TPSA | 76.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|