About N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide
N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 142528293) has the molecular formula C10H10N2OS
and a molecular weight of 206.27 g/mol. Its IUPAC name is N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| PubChem CID | 142528293 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc2ccc(C)nc2s1 |
| InChI | InChI=1S/C10H10N2OS/c1-6-3-4-7-5-8(9(13)11-2)14-10(7)12-6/h3-5H,1-2H3,(H,11,13) |
| InChIKey | XPDHRDVMPUSCKM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide?
The IUPAC name of N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (CID 142528293) is N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide.
What is the SMILES notation for N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide?
The canonical SMILES for N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide is CNC(=O)c1cc2ccc(C)nc2s1.
What is the InChIKey of N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide?
The InChIKey is XPDHRDVMPUSCKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2OS/c1-6-3-4-7-5-8(9(13)11-2)14-10(7)12-6/h3-5H,1-2H3,(H,11,13).
What are the key properties of N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide?
N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide has a molecular weight of 206.27 g/mol, XLogP of 1.96, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide is sourced from PubChem (CID 142528293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).