C27H32FN5O6S — CID 142528421
tert-butyl 4-[3-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]-5-fluoro-4,4-dihydroxy-2,3-dihydrochromen-7-yl]piperazine-1-carboxylate (PubChem CID 142528421) has the molecular formula C27H32FN5O6S and a molecular weight of 573.65 g/mol. Its IUPAC name is tert-butyl 4-[3-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]-5-fluoro-4,4-dihydroxy-2,3-dihydrochromen-7-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]-5-fluoro-4,4-dihydroxy-2,3-dihydrochromen-7-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142528421 |
| Molecular Formula | C27H32FN5O6S |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | tert-butyl 4-[3-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]-5-fluoro-4,4-dihydroxy-2,3-dihydrochromen-7-yl]piperazine-1-carboxylate |
| SMILES | Cc1ccc2c(N)c(C(=O)NC3COc4cc(N5CCN(C(=O)OC(C)(C)C)CC5)cc(F)c4C3(O)O)sc2n1 |
| InChI | InChI=1S/C27H32FN5O6S/c1-14-5-6-16-21(29)22(40-24(16)30-14)23(34)31-19-13-38-18-12-15(11-17(28)20(18)27(19,36)37)32-7-9-33(10-8-32)25(35)39-26(2,3)4/h5-6,11-12,19,36-37H,7-10,13,29H2,1-4H3,(H,31,34) |
| InChIKey | XRXXKKHMUVUTJZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|