C21H39FN2O6 — CID 142528797
(2S,5S)-N-[(1R,2R)-1-[(2R,5R)-6-ethyl-3,4,5-trihydroxyoxan-2-yl]-2-hydroxypropyl]-5-(4-fluorobutyl)azepane-2-carboxamide (PubChem CID 142528797) has the molecular formula C21H39FN2O6 and a molecular weight of 434.55 g/mol. Its IUPAC name is (2S,5S)-N-[(1R,2R)-1-[(2R,5R)-6-ethyl-3,4,5-trihydroxyoxan-2-yl]-2-hydroxypropyl]-5-(4-fluorobutyl)azepane-2-carboxamide.
| Compound Name | (2S,5S)-N-[(1R,2R)-1-[(2R,5R)-6-ethyl-3,4,5-trihydroxyoxan-2-yl]-2-hydroxypropyl]-5-(4-fluorobutyl)azepane-2-carboxamide |
|---|---|
| PubChem CID | 142528797 |
| Molecular Formula | C21H39FN2O6 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | (2S,5S)-N-[(1R,2R)-1-[(2R,5R)-6-ethyl-3,4,5-trihydroxyoxan-2-yl]-2-hydroxypropyl]-5-(4-fluorobutyl)azepane-2-carboxamide |
| SMILES | CCC1O[C@H]([C@H](NC(=O)[C@@H]2CC[C@H](CCCCF)CCN2)[C@@H](C)O)C(O)C(O)[C@H]1O |
| InChI | InChI=1S/C21H39FN2O6/c1-3-15-17(26)18(27)19(28)20(30-15)16(12(2)25)24-21(29)14-8-7-13(9-11-23-14)6-4-5-10-22/h12-20,23,25-28H,3-11H2,1-2H3,(H,24,29)/t12-,13+,14+,15?,16-,17+,18?,19?,20-/m1/s1 |
| InChIKey | MCJOBDVZTOYYEM-ZKMPEOIKSA-N |
| XLogP | 0.01 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|