C20H38FN3O6 — CID 142528834
(2S,5S)-N-[(1R,2R)-1-[(2R,5R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]-2-hydroxypropyl]-5-(4-fluorobutyl)azepane-2-carboxamide (PubChem CID 142528834) has the molecular formula C20H38FN3O6 and a molecular weight of 435.54 g/mol. Its IUPAC name is (2S,5S)-N-[(1R,2R)-1-[(2R,5R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]-2-hydroxypropyl]-5-(4-fluorobutyl)azepane-2-carboxamide.
| Compound Name | (2S,5S)-N-[(1R,2R)-1-[(2R,5R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]-2-hydroxypropyl]-5-(4-fluorobutyl)azepane-2-carboxamide |
|---|---|
| PubChem CID | 142528834 |
| Molecular Formula | C20H38FN3O6 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | (2S,5S)-N-[(1R,2R)-1-[(2R,5R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]-2-hydroxypropyl]-5-(4-fluorobutyl)azepane-2-carboxamide |
| SMILES | C[C@@H](O)[C@@H](NC(=O)[C@@H]1CC[C@H](CCCCF)CCN1)[C@H]1OC(CN)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C20H38FN3O6/c1-11(25)15(19-18(28)17(27)16(26)14(10-22)30-19)24-20(29)13-6-5-12(7-9-23-13)4-2-3-8-21/h11-19,23,25-28H,2-10,22H2,1H3,(H,24,29)/t11-,12+,13+,14?,15-,16+,17?,18?,19-/m1/s1 |
| InChIKey | BHEKZCITSOSPLN-COSDDDLNSA-N |
| XLogP | -1.44 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|