C21H40O3 — CID 142528959
3,5,9-trimethyltetradec-1-en-6-yl 2-methoxypropanoate (PubChem CID 142528959) has the molecular formula C21H40O3 and a molecular weight of 340.55 g/mol. Its IUPAC name is 3,5,9-trimethyltetradec-1-en-6-yl 2-methoxypropanoate.
| Compound Name | 3,5,9-trimethyltetradec-1-en-6-yl 2-methoxypropanoate |
|---|---|
| PubChem CID | 142528959 |
| Molecular Formula | C21H40O3 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | 3,5,9-trimethyltetradec-1-en-6-yl 2-methoxypropanoate |
| SMILES | C=CC(C)CC(C)C(CCC(C)CCCCC)OC(=O)C(C)OC |
| InChI | InChI=1S/C21H40O3/c1-8-10-11-12-17(4)13-14-20(18(5)15-16(3)9-2)24-21(22)19(6)23-7/h9,16-20H,2,8,10-15H2,1,3-7H3 |
| InChIKey | IRHLDZMCPHVOKI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|