About butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene
butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene (PubChem CID 142529024) has the molecular formula C25H40
and a molecular weight of 340.60 g/mol. Its IUPAC name is butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene.
Molecular Properties
| Compound Name | butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene |
| PubChem CID | 142529024 |
| Molecular Formula | C25H40 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene |
| SMILES | C=C(c1ccc(C)cc1)C1(C)CCCCC1.C=CC(=C)C.CCCC |
| InChI | InChI=1S/C16H22.C5H8.C4H10/c1-13-7-9-15(10-8-13)14(2)16(3)11-5-4-6-12-16;1-4-5(2)3;1-3-4-2/h7-10H,2,4-6,11-12H2,1,3H3;4H,1-2H2,3H3;3-4H2,1-2H3 |
| InChIKey | KSFLLIQYQWOLCI-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene?
The IUPAC name of butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene (CID 142529024) is butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene.
What is the SMILES notation for butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene?
The canonical SMILES for butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene is C=C(c1ccc(C)cc1)C1(C)CCCCC1.C=CC(=C)C.CCCC.
What is the InChIKey of butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene?
The InChIKey is KSFLLIQYQWOLCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22.C5H8.C4H10/c1-13-7-9-15(10-8-13)14(2)16(3)11-5-4-6-12-16;1-4-5(2)3;1-3-4-2/h7-10H,2,4-6,11-12H2,1,3H3;4H,1-2H2,3H3;3-4H2,1-2H3.
What are the key properties of butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene?
butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene has a molecular weight of 340.60 g/mol, XLogP of 8.53, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;2-methylbuta-1,3-diene;1-methyl-4-[1-(1-methylcyclohexyl)ethenyl]benzene is sourced from PubChem (CID 142529024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).