About ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde
ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde (PubChem CID 142529758) has the molecular formula C19H26N2O2S
and a molecular weight of 346.50 g/mol. Its IUPAC name is ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde.
Molecular Properties
| Compound Name | ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde |
| PubChem CID | 142529758 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde |
| SMILES | CC.COCc1ccccc1.O=CN1CC(Sc2ccccn2)C1 |
| InChI | InChI=1S/C9H10N2OS.C8H10O.C2H6/c12-7-11-5-8(6-11)13-9-3-1-2-4-10-9;1-9-7-8-5-3-2-4-6-8;1-2/h1-4,7-8H,5-6H2;2-6H,7H2,1H3;1-2H3 |
| InChIKey | YYWJEJZWLDVEPX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde?
The IUPAC name of ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde (CID 142529758) is ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde.
What is the SMILES notation for ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde?
The canonical SMILES for ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde is CC.COCc1ccccc1.O=CN1CC(Sc2ccccn2)C1.
What is the InChIKey of ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde?
The InChIKey is YYWJEJZWLDVEPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2OS.C8H10O.C2H6/c12-7-11-5-8(6-11)13-9-3-1-2-4-10-9;1-9-7-8-5-3-2-4-6-8;1-2/h1-4,7-8H,5-6H2;2-6H,7H2,1H3;1-2H3.
What are the key properties of ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde?
ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde has a molecular weight of 346.50 g/mol, XLogP of 3.87, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methoxymethylbenzene;3-pyridin-2-ylsulfanylazetidine-1-carbaldehyde is sourced from PubChem (CID 142529758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).