C16H16F6N3O3+ — CID 142529946
1,1,1-trifluoro-2-methoxyethane;3-[4-[3-(trifluoromethyl)-2-pyridinyl]pyridazin-1-ium-1-yl]propanoic acid (PubChem CID 142529946) has the molecular formula C16H16F6N3O3+ and a molecular weight of 412.31 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-methoxyethane;3-[4-[3-(trifluoromethyl)-2-pyridinyl]pyridazin-1-ium-1-yl]propanoic acid.
| Compound Name | 1,1,1-trifluoro-2-methoxyethane;3-[4-[3-(trifluoromethyl)-2-pyridinyl]pyridazin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 142529946 |
| Molecular Formula | C16H16F6N3O3+ |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 1,1,1-trifluoro-2-methoxyethane;3-[4-[3-(trifluoromethyl)-2-pyridinyl]pyridazin-1-ium-1-yl]propanoic acid |
| SMILES | COCC(F)(F)F.O=C(O)CC[n+]1ccc(-c2ncccc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H10F3N3O2.C3H5F3O/c14-13(15,16)10-2-1-5-17-12(10)9-3-6-19(18-8-9)7-4-11(20)21;1-7-2-3(4,5)6/h1-3,5-6,8H,4,7H2;2H2,1H3/p+1 |
| InChIKey | QSWLIRUHCIVTIF-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|