C15H15F5N3O3+ — CID 142529983
3-[4-(3,5-difluoro-2-pyridinyl)pyridazin-1-ium-1-yl]propanoic acid;1,1,1-trifluoro-2-methoxyethane (PubChem CID 142529983) has the molecular formula C15H15F5N3O3+ and a molecular weight of 380.29 g/mol. Its IUPAC name is 3-[4-(3,5-difluoro-2-pyridinyl)pyridazin-1-ium-1-yl]propanoic acid;1,1,1-trifluoro-2-methoxyethane.
| Compound Name | 3-[4-(3,5-difluoro-2-pyridinyl)pyridazin-1-ium-1-yl]propanoic acid;1,1,1-trifluoro-2-methoxyethane |
|---|---|
| PubChem CID | 142529983 |
| Molecular Formula | C15H15F5N3O3+ |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 3-[4-(3,5-difluoro-2-pyridinyl)pyridazin-1-ium-1-yl]propanoic acid;1,1,1-trifluoro-2-methoxyethane |
| SMILES | COCC(F)(F)F.O=C(O)CC[n+]1ccc(-c2ncc(F)cc2F)cn1 |
| InChI | InChI=1S/C12H9F2N3O2.C3H5F3O/c13-9-5-10(14)12(15-7-9)8-1-3-17(16-6-8)4-2-11(18)19;1-7-2-3(4,5)6/h1,3,5-7H,2,4H2;2H2,1H3/p+1 |
| InChIKey | VJTDWMRQEZXLFV-UHFFFAOYSA-O |
| XLogP | 2.38 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|