About ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine
ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine (PubChem CID 142530052) has the molecular formula C18H36N10
and a molecular weight of 392.56 g/mol. Its IUPAC name is ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine.
Molecular Properties
| Compound Name | ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine |
| PubChem CID | 142530052 |
| Molecular Formula | C18H36N10 |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine |
| SMILES | CC.CN1CCN(c2nc(N3CCNCC3)nc(N3CCN(N)CC3)n2)CC1 |
| InChI | InChI=1S/C16H30N10.C2H6/c1-22-6-8-24(9-7-22)15-19-14(23-4-2-18-3-5-23)20-16(21-15)25-10-12-26(17)13-11-25;1-2/h18H,2-13,17H2,1H3;1-2H3 |
| InChIKey | PVVVVKIVTGLKBR-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine?
The IUPAC name of ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine (CID 142530052) is ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine.
What is the SMILES notation for ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine?
The canonical SMILES for ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine is CC.CN1CCN(c2nc(N3CCNCC3)nc(N3CCN(N)CC3)n2)CC1.
What is the InChIKey of ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine?
The InChIKey is PVVVVKIVTGLKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N10.C2H6/c1-22-6-8-24(9-7-22)15-19-14(23-4-2-18-3-5-23)20-16(21-15)25-10-12-26(17)13-11-25;1-2/h18H,2-13,17H2,1H3;1-2H3.
What are the key properties of ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine?
ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine has a molecular weight of 392.56 g/mol, XLogP of -0.95, 3 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[4-(4-methylpiperazin-1-yl)-6-piperazin-1-yl-1,3,5-triazin-2-yl]piperazin-1-amine is sourced from PubChem (CID 142530052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).