C27H39FN6OSi — CID 142530149
2-[[4-[(3S)-3-(4-fluoropiperidin-1-yl)piperidin-1-yl]-3-pyrimidin-5-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 142530149) has the molecular formula C27H39FN6OSi and a molecular weight of 510.73 g/mol. Its IUPAC name is 2-[[4-[(3S)-3-(4-fluoropiperidin-1-yl)piperidin-1-yl]-3-pyrimidin-5-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[(3S)-3-(4-fluoropiperidin-1-yl)piperidin-1-yl]-3-pyrimidin-5-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 142530149 |
| Molecular Formula | C27H39FN6OSi |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 2-[[4-[(3S)-3-(4-fluoropiperidin-1-yl)piperidin-1-yl]-3-pyrimidin-5-ylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cncnc2)c2c(N3CCC[C@H](N4CCC(F)CC4)C3)ccnc21 |
| InChI | InChI=1S/C27H39FN6OSi/c1-36(2,3)14-13-35-20-34-18-24(21-15-29-19-30-16-21)26-25(6-9-31-27(26)34)33-10-4-5-23(17-33)32-11-7-22(28)8-12-32/h6,9,15-16,18-19,22-23H,4-5,7-8,10-14,17,20H2,1-3H3/t23-/m0/s1 |
| InChIKey | HBXKRKBGXCJVGY-QHCPKHFHSA-N |
| XLogP | 5.21 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|