C17H25NO — CID 142530521
1-[4,5,6-trimethyl-2-(methyliminomethyl)-3-(2-methylprop-2-enyl)cyclohexa-1,3-dien-1-yl]ethanone (PubChem CID 142530521) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-[4,5,6-trimethyl-2-(methyliminomethyl)-3-(2-methylprop-2-enyl)cyclohexa-1,3-dien-1-yl]ethanone.
| Compound Name | 1-[4,5,6-trimethyl-2-(methyliminomethyl)-3-(2-methylprop-2-enyl)cyclohexa-1,3-dien-1-yl]ethanone |
|---|---|
| PubChem CID | 142530521 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 1-[4,5,6-trimethyl-2-(methyliminomethyl)-3-(2-methylprop-2-enyl)cyclohexa-1,3-dien-1-yl]ethanone |
| SMILES | C=C(C)CC1=C(C)C(C)C(C)C(C(C)=O)=C1/C=N/C |
| InChI | InChI=1S/C17H25NO/c1-10(2)8-15-12(4)11(3)13(5)17(14(6)19)16(15)9-18-7/h9,11,13H,1,8H2,2-7H3/b18-9+ |
| InChIKey | DOVCVMHFWTWJTQ-GIJQJNRQSA-N |
| XLogP | 4.14 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|