C13H18N4O3S — CID 142530814
N-[2-(2-hydroxyethoxy)ethyl]-6-methanimidoyl-2,4-dimethylpyrrolo[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 142530814) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)ethyl]-6-methanimidoyl-2,4-dimethylpyrrolo[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | N-[2-(2-hydroxyethoxy)ethyl]-6-methanimidoyl-2,4-dimethylpyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 142530814 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)ethyl]-6-methanimidoyl-2,4-dimethylpyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | [H]/N=C/c1c(C(=O)NCCOCCO)n(C)c2nc(C)sc12 |
| InChI | InChI=1S/C13H18N4O3S/c1-8-16-12-11(21-8)9(7-14)10(17(12)2)13(19)15-3-5-20-6-4-18/h7,14,18H,3-6H2,1-2H3,(H,15,19)/b14-7+ |
| InChIKey | ZASFNHRMVRCGQN-VGOFMYFVSA-N |
| XLogP | 0.68 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|