C33H31FN2O3 — CID 142531734
2-[2-fluoro-6-[C-methyl-N-(2-methylphenyl)carbonimidoyl]phenyl]-5-[[(1R)-1-phenylbutyl]carbamoyl]benzoic acid (PubChem CID 142531734) has the molecular formula C33H31FN2O3 and a molecular weight of 522.62 g/mol. Its IUPAC name is 2-[2-fluoro-6-[C-methyl-N-(2-methylphenyl)carbonimidoyl]phenyl]-5-[[(1R)-1-phenylbutyl]carbamoyl]benzoic acid.
| Compound Name | 2-[2-fluoro-6-[C-methyl-N-(2-methylphenyl)carbonimidoyl]phenyl]-5-[[(1R)-1-phenylbutyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 142531734 |
| Molecular Formula | C33H31FN2O3 |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 2-[2-fluoro-6-[C-methyl-N-(2-methylphenyl)carbonimidoyl]phenyl]-5-[[(1R)-1-phenylbutyl]carbamoyl]benzoic acid |
| SMILES | CCC[C@@H](NC(=O)c1ccc(-c2c(F)cccc2/C(C)=N/c2ccccc2C)c(C(=O)O)c1)c1ccccc1 |
| InChI | InChI=1S/C33H31FN2O3/c1-4-11-30(23-13-6-5-7-14-23)36-32(37)24-18-19-26(27(20-24)33(38)39)31-25(15-10-16-28(31)34)22(3)35-29-17-9-8-12-21(29)2/h5-10,12-20,30H,4,11H2,1-3H3,(H,36,37)(H,38,39)/b35-22+/t30-/m1/s1 |
| InChIKey | XTCBANSSUKAPGI-RBIQANPVSA-N |
| XLogP | 7.91 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|