About N,N-diazidoaniline
N,N-diazidoaniline (PubChem CID 142533024) has the molecular formula C6H5N7
and a molecular weight of 175.16 g/mol. Its IUPAC name is N,N-diazidoaniline.
Molecular Properties
| Compound Name | N,N-diazidoaniline |
| PubChem CID | 142533024 |
| Molecular Formula | C6H5N7 |
| Molecular Weight | 175.16 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | N,N-diazidoaniline |
| SMILES | [N-]=[N+]=NN(N=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C6H5N7/c7-9-11-13(12-10-8)6-4-2-1-3-5-6/h1-5H |
| InChIKey | JPWHGLBMAHEPLD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 100.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.16 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N,N-diazidoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diazidoaniline?
The IUPAC name of N,N-diazidoaniline (CID 142533024) is N,N-diazidoaniline.
What is the SMILES notation for N,N-diazidoaniline?
The canonical SMILES for N,N-diazidoaniline is [N-]=[N+]=NN(N=[N+]=[N-])c1ccccc1.
What is the InChIKey of N,N-diazidoaniline?
The InChIKey is JPWHGLBMAHEPLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N7/c7-9-11-13(12-10-8)6-4-2-1-3-5-6/h1-5H.
What are the key properties of N,N-diazidoaniline?
N,N-diazidoaniline has a molecular weight of 175.16 g/mol, XLogP of 2.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diazidoaniline is sourced from PubChem (CID 142533024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).