C13H23N3O2 — CID 142533042
1-(4-amino-2,2,4-trimethylpentyl)-5-methylpyrimidine-2,4-dione (PubChem CID 142533042) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 1-(4-amino-2,2,4-trimethylpentyl)-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-(4-amino-2,2,4-trimethylpentyl)-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142533042 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-(4-amino-2,2,4-trimethylpentyl)-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(CC(C)(C)CC(C)(C)N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H23N3O2/c1-9-6-16(11(18)15-10(9)17)8-12(2,3)7-13(4,5)14/h6H,7-8,14H2,1-5H3,(H,15,17,18) |
| InChIKey | YJWURGXFEYJOTO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |