C19H27N3O2S — CID 142533234
1-[[5-hydroxy-2-(methylamino)-1,3-dihydroinden-2-yl]methyl]-3-[(4Z)-4-(sulfanylmethylidene)hex-5-en-2-yl]urea (PubChem CID 142533234) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is 1-[[5-hydroxy-2-(methylamino)-1,3-dihydroinden-2-yl]methyl]-3-[(4Z)-4-(sulfanylmethylidene)hex-5-en-2-yl]urea.
| Compound Name | 1-[[5-hydroxy-2-(methylamino)-1,3-dihydroinden-2-yl]methyl]-3-[(4Z)-4-(sulfanylmethylidene)hex-5-en-2-yl]urea |
|---|---|
| PubChem CID | 142533234 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-[[5-hydroxy-2-(methylamino)-1,3-dihydroinden-2-yl]methyl]-3-[(4Z)-4-(sulfanylmethylidene)hex-5-en-2-yl]urea |
| SMILES | C=C/C(=C\S)CC(C)NC(=O)NCC1(NC)Cc2ccc(O)cc2C1 |
| InChI | InChI=1S/C19H27N3O2S/c1-4-14(11-25)7-13(2)22-18(24)21-12-19(20-3)9-15-5-6-17(23)8-16(15)10-19/h4-6,8,11,13,20,23,25H,1,7,9-10,12H2,2-3H3,(H2,21,22,24)/b14-11+ |
| InChIKey | IVHKLNBBUMVHHE-SDNWHVSQSA-N |
| XLogP | 2.53 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|