C19H21N3OS — CID 142533284
5-[1-(4-pyridin-3-yloxypiperidin-1-yl)ethyl]-1,3-benzothiazole (PubChem CID 142533284) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 5-[1-(4-pyridin-3-yloxypiperidin-1-yl)ethyl]-1,3-benzothiazole.
| Compound Name | 5-[1-(4-pyridin-3-yloxypiperidin-1-yl)ethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 142533284 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 5-[1-(4-pyridin-3-yloxypiperidin-1-yl)ethyl]-1,3-benzothiazole |
| SMILES | CC(c1ccc2scnc2c1)N1CCC(Oc2cccnc2)CC1 |
| InChI | InChI=1S/C19H21N3OS/c1-14(15-4-5-19-18(11-15)21-13-24-19)22-9-6-16(7-10-22)23-17-3-2-8-20-12-17/h2-5,8,11-14,16H,6-7,9-10H2,1H3 |
| InChIKey | HOTACKPBKZFLSA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |