C17H20BNO5 — CID 142533492
[(1R)-2-(1-benzofuran-3-yl)-1-[[(1R,2S,4S)-7-oxabicyclo[2.2.1]heptane-2-carbonyl]amino]ethyl]boronic acid (PubChem CID 142533492) has the molecular formula C17H20BNO5 and a molecular weight of 329.16 g/mol. Its IUPAC name is [(1R)-2-(1-benzofuran-3-yl)-1-[[(1R,2S,4S)-7-oxabicyclo[2.2.1]heptane-2-carbonyl]amino]ethyl]boronic acid.
| Compound Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(1R,2S,4S)-7-oxabicyclo[2.2.1]heptane-2-carbonyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 142533492 |
| Molecular Formula | C17H20BNO5 |
| Molecular Weight | 329.16 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [(1R)-2-(1-benzofuran-3-yl)-1-[[(1R,2S,4S)-7-oxabicyclo[2.2.1]heptane-2-carbonyl]amino]ethyl]boronic acid |
| SMILES | O=C(N[C@@H](Cc1coc2ccccc12)B(O)O)[C@H]1C[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C17H20BNO5/c20-17(13-8-11-5-6-15(13)24-11)19-16(18(21)22)7-10-9-23-14-4-2-1-3-12(10)14/h1-4,9,11,13,15-16,21-22H,5-8H2,(H,19,20)/t11-,13-,15+,16-/m0/s1 |
| InChIKey | RFQDLTYXNINJON-YUDUHTQSSA-N |
| XLogP | 1.04 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.16 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|