C14H23NOS — CID 142533899
4-[(3E,5Z)-5-propan-2-ylhepta-1,3,5-trien-3-yl]-1,4-thiazinane 1-oxide (PubChem CID 142533899) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is 4-[(3E,5Z)-5-propan-2-ylhepta-1,3,5-trien-3-yl]-1,4-thiazinane 1-oxide.
| Compound Name | 4-[(3E,5Z)-5-propan-2-ylhepta-1,3,5-trien-3-yl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 142533899 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 4-[(3E,5Z)-5-propan-2-ylhepta-1,3,5-trien-3-yl]-1,4-thiazinane 1-oxide |
| SMILES | C=C/C(=C\C(=C/C)C(C)C)N1CCS(=O)CC1 |
| InChI | InChI=1S/C14H23NOS/c1-5-13(12(3)4)11-14(6-2)15-7-9-17(16)10-8-15/h5-6,11-12H,2,7-10H2,1,3-4H3/b13-5+,14-11+ |
| InChIKey | BIWOUVNEANLNAW-ITAUJFPCSA-N |
| XLogP | 2.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|