About 7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol
7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol (PubChem CID 142534454) has the molecular formula C14H22ClN5O
and a molecular weight of 311.82 g/mol. Its IUPAC name is 7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol.
Molecular Properties
| Compound Name | 7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol |
| PubChem CID | 142534454 |
| Molecular Formula | C14H22ClN5O |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol |
| SMILES | CCCCC(C)CO.Nc1nc(N)c2ncc(Cl)cc2n1 |
| InChI | InChI=1S/C7H6ClN5.C7H16O/c8-3-1-4-5(11-2-3)6(9)13-7(10)12-4;1-3-4-5-7(2)6-8/h1-2H,(H4,9,10,12,13);7-8H,3-6H2,1-2H3 |
| InChIKey | UTIWCQWOBOHCSR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol?
The IUPAC name of 7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol (CID 142534454) is 7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol.
What is the SMILES notation for 7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol?
The canonical SMILES for 7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol is CCCCC(C)CO.Nc1nc(N)c2ncc(Cl)cc2n1.
What is the InChIKey of 7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol?
The InChIKey is UTIWCQWOBOHCSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN5.C7H16O/c8-3-1-4-5(11-2-3)6(9)13-7(10)12-4;1-3-4-5-7(2)6-8/h1-2H,(H4,9,10,12,13);7-8H,3-6H2,1-2H3.
What are the key properties of 7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol?
7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol has a molecular weight of 311.82 g/mol, XLogP of 2.65, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloropyrido[3,2-d]pyrimidine-2,4-diamine;2-methylhexan-1-ol is sourced from PubChem (CID 142534454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).