C25H21ClN2O4 — CID 142535085
N-[[4-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-2-cyano-3-(2,4-dihydroxyphenyl)prop-2-enamide (PubChem CID 142535085) has the molecular formula C25H21ClN2O4 and a molecular weight of 448.91 g/mol. Its IUPAC name is N-[[4-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-2-cyano-3-(2,4-dihydroxyphenyl)prop-2-enamide.
| Compound Name | N-[[4-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-2-cyano-3-(2,4-dihydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 142535085 |
| Molecular Formula | C25H21ClN2O4 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-[[4-(4-chloro-3,5-dimethylphenoxy)phenyl]methyl]-2-cyano-3-(2,4-dihydroxyphenyl)prop-2-enamide |
| SMILES | Cc1cc(Oc2ccc(CNC(=O)C(C#N)=Cc3ccc(O)cc3O)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C25H21ClN2O4/c1-15-9-22(10-16(2)24(15)26)32-21-7-3-17(4-8-21)14-28-25(31)19(13-27)11-18-5-6-20(29)12-23(18)30/h3-12,29-30H,14H2,1-2H3,(H,28,31) |
| InChIKey | KAECBIBTWBIOLK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|