C22H23NO5 — CID 142535266
4-[[2-(1-ethoxyethenyl)-4,5-dimethoxyphenyl]methyl]-3-phenyl-4H-1,2-oxazol-5-one (PubChem CID 142535266) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-[[2-(1-ethoxyethenyl)-4,5-dimethoxyphenyl]methyl]-3-phenyl-4H-1,2-oxazol-5-one.
| Compound Name | 4-[[2-(1-ethoxyethenyl)-4,5-dimethoxyphenyl]methyl]-3-phenyl-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 142535266 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-[[2-(1-ethoxyethenyl)-4,5-dimethoxyphenyl]methyl]-3-phenyl-4H-1,2-oxazol-5-one |
| SMILES | C=C(OCC)c1cc(OC)c(OC)cc1CC1C(=O)ON=C1c1ccccc1 |
| InChI | InChI=1S/C22H23NO5/c1-5-27-14(2)17-13-20(26-4)19(25-3)12-16(17)11-18-21(23-28-22(18)24)15-9-7-6-8-10-15/h6-10,12-13,18H,2,5,11H2,1,3-4H3 |
| InChIKey | BVKXSCKNWFETOE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|