C21H30 — CID 142535991
3,10-dimethyl-5,6,7,8,9,10-hexahydrobenzo[a]azulene;pent-1-ene (PubChem CID 142535991) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is 3,10-dimethyl-5,6,7,8,9,10-hexahydrobenzo[a]azulene;pent-1-ene.
| Compound Name | 3,10-dimethyl-5,6,7,8,9,10-hexahydrobenzo[a]azulene;pent-1-ene |
|---|---|
| PubChem CID | 142535991 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 3,10-dimethyl-5,6,7,8,9,10-hexahydrobenzo[a]azulene;pent-1-ene |
| SMILES | C=CCCC.Cc1ccc2c(c1)C1=C(CCCCC1)C2C |
| InChI | InChI=1S/C16H20.C5H10/c1-11-8-9-14-12(2)13-6-4-3-5-7-15(13)16(14)10-11;1-3-5-4-2/h8-10,12H,3-7H2,1-2H3;3H,1,4-5H2,2H3 |
| InChIKey | UZZPPKDELJPKFL-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|