C11H21NOS — CID 142537443
(1R)-N-tert-butylsulfanyl-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]ethanamine (PubChem CID 142537443) has the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. Its IUPAC name is (1R)-N-tert-butylsulfanyl-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]ethanamine.
| Compound Name | (1R)-N-tert-butylsulfanyl-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]ethanamine |
|---|---|
| PubChem CID | 142537443 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (1R)-N-tert-butylsulfanyl-1-[(2S)-3,4-dihydro-2H-pyran-2-yl]ethanamine |
| SMILES | C[C@@H](NSC(C)(C)C)[C@@H]1CCC=CO1 |
| InChI | InChI=1S/C11H21NOS/c1-9(12-14-11(2,3)4)10-7-5-6-8-13-10/h6,8-10,12H,5,7H2,1-4H3/t9-,10+/m1/s1 |
| InChIKey | ZKDBRYYLBMDDGG-ZJUUUORDSA-N |
| XLogP | 3.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|