About but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine
but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine (PubChem CID 142537452) has the molecular formula C12H22F3N
and a molecular weight of 237.31 g/mol. Its IUPAC name is but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine.
Molecular Properties
| Compound Name | but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine |
| PubChem CID | 142537452 |
| Molecular Formula | C12H22F3N |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine |
| SMILES | CC=CC.NC(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C8H14F3N.C4H8/c9-8(10,11)7(12)6-4-2-1-3-5-6;1-3-4-2/h6-7H,1-5,12H2;3-4H,1-2H3 |
| InChIKey | VWMUBGPEAYQRBG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine?
The IUPAC name of but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine (CID 142537452) is but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine.
What is the SMILES notation for but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine?
The canonical SMILES for but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine is CC=CC.NC(C1CCCCC1)C(F)(F)F.
What is the InChIKey of but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine?
The InChIKey is VWMUBGPEAYQRBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3N.C4H8/c9-8(10,11)7(12)6-4-2-1-3-5-6;1-3-4-2/h6-7H,1-5,12H2;3-4H,1-2H3.
What are the key properties of but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine?
but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine has a molecular weight of 237.31 g/mol, XLogP of 4.04, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-ene;1-cyclohexyl-2,2,2-trifluoroethanamine is sourced from PubChem (CID 142537452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).